C37H64N8O4 — CID 173377549
ethyl 2-[[4-[[2-ethoxy-2-oxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)ethylidene]amino]-6-(2,4,4-trimethylpentan-2-ylamino)-1,3,5-triazin-2-yl]imino]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetate (PubChem CID 173377549) has the molecular formula C37H64N8O4 and a molecular weight of 684.97 g/mol. Its IUPAC name is ethyl 2-[[4-[[2-ethoxy-2-oxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)ethylidene]amino]-6-(2,4,4-trimethylpentan-2-ylamino)-1,3,5-triazin-2-yl]imino]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetate.
| Compound Name | ethyl 2-[[4-[[2-ethoxy-2-oxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)ethylidene]amino]-6-(2,4,4-trimethylpentan-2-ylamino)-1,3,5-triazin-2-yl]imino]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetate |
|---|---|
| PubChem CID | 173377549 |
| Molecular Formula | C37H64N8O4 |
| Molecular Weight | 684.97 g/mol |
| Exact Mass | 684.51 |
| IUPAC Name | ethyl 2-[[4-[[2-ethoxy-2-oxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)ethylidene]amino]-6-(2,4,4-trimethylpentan-2-ylamino)-1,3,5-triazin-2-yl]imino]-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetate |
| SMILES | CCOC(=O)C(=Nc1nc(N=C(C(=O)OCC)C2CC(C)(C)NC(C)(C)C2)nc(NC(C)(C)CC(C)(C)C)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C37H64N8O4/c1-16-48-27(46)25(23-18-33(6,7)44-34(8,9)19-23)38-29-40-30(42-31(41-29)43-37(14,15)22-32(3,4)5)39-26(28(47)49-17-2)24-20-35(10,11)45-36(12,13)21-24/h23-24,44-45H,16-22H2,1-15H3,(H,40,41,42,43) |
| InChIKey | DKKOBVSLCZUNHG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.97 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|