C26H28N10NaO8S3 — CID 173378084
CID 173378084 (PubChem CID 173378084) has the molecular formula C26H28N10NaO8S3 and a molecular weight of 727.76 g/mol.
| Compound Name | CID 173378084 |
|---|---|
| PubChem CID | 173378084 |
| Molecular Formula | C26H28N10NaO8S3 |
| Molecular Weight | 727.76 g/mol |
| Exact Mass | 727.12 |
| IUPAC Name | — |
| SMILES | Cc1cc(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)C(=NOCC(=O)OC(C)(C)C)c4csc(N)n4)[C@H]3SC2)n2nc(C(N)=O)nc2n1.[Na] |
| InChI | InChI=1S/C26H28N10O8S3.Na/c1-10-5-13(36-25(29-10)32-19(33-36)18(27)38)45-7-11-8-46-22-16(21(40)35(22)17(11)23(41)42)31-20(39)15(12-9-47-24(28)30-12)34-43-6-14(37)44-26(2,3)4;/h5,9,16,22H,6-8H2,1-4H3,(H2,27,38)(H2,28,30)(H,31,39)(H,41,42);/t16-,22-;/m1./s1 |
| InChIKey | BHQGZXZCSAXPSB-BYYQELCVSA-N |
| XLogP | -0.22 |
| TPSA | 259.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.76 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|