C32H44N2O5S2Si2 — CID 173378236
5-[2-[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 173378236) has the molecular formula C32H44N2O5S2Si2 and a molecular weight of 657.02 g/mol. Its IUPAC name is 5-[2-[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[2-[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 173378236 |
| Molecular Formula | C32H44N2O5S2Si2 |
| Molecular Weight | 657.02 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | 5-[2-[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]ethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1C(CCc1ccc(CC=C2SC(=O)NC2=O)s1)(O[SiH](C)C(C)(C)C)O[SiH](C)C(C)(C)C |
| InChI | InChI=1S/C32H44N2O5S2Si2/c1-21-26(33-28(37-21)22-13-11-10-12-14-22)32(38-42(8)30(2,3)4,39-43(9)31(5,6)7)20-19-24-16-15-23(40-24)17-18-25-27(35)34-29(36)41-25/h10-16,18,42-43H,17,19-20H2,1-9H3,(H,34,35,36) |
| InChIKey | VGTBOQIVUAIUCF-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.02 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|