About 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one
2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one (PubChem CID 173379004) has the molecular formula C5H6F3N2O+
and a molecular weight of 167.11 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one |
| PubChem CID | 173379004 |
| Molecular Formula | C5H6F3N2O+ |
| Molecular Weight | 167.11 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one |
| SMILES | O=C1CC[NH+]=C(C(F)(F)F)N1 |
| InChI | InChI=1S/C5H5F3N2O/c6-5(7,8)4-9-2-1-3(11)10-4/h1-2H2,(H,9,10,11)/p+1 |
| InChIKey | TWRORTFZBJZPHA-UHFFFAOYSA-O |
| XLogP | -1.45 |
| TPSA | 43.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.11 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one?
The IUPAC name of 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one (CID 173379004) is 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one.
What is the SMILES notation for 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one?
The canonical SMILES for 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one is O=C1CC[NH+]=C(C(F)(F)F)N1.
What is the InChIKey of 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one?
The InChIKey is TWRORTFZBJZPHA-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H5F3N2O/c6-5(7,8)4-9-2-1-3(11)10-4/h1-2H2,(H,9,10,11)/p+1.
What are the key properties of 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one?
2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one has a molecular weight of 167.11 g/mol, XLogP of -1.45, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-4,5-dihydro-1H-pyrimidin-3-ium-6-one is sourced from PubChem (CID 173379004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).