About 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole
4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole (PubChem CID 173379063) has the molecular formula C6H11FN2
and a molecular weight of 130.17 g/mol. Its IUPAC name is 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 173379063 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole |
| SMILES | CCC1N=CNC1CF |
| InChI | InChI=1S/C6H11FN2/c1-2-5-6(3-7)9-4-8-5/h4-6H,2-3H2,1H3,(H,8,9) |
| InChIKey | ZKLKNMLNIVESFO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole (CID 173379063) is 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole is CCC1N=CNC1CF.
What is the InChIKey of 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is ZKLKNMLNIVESFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN2/c1-2-5-6(3-7)9-4-8-5/h4-6H,2-3H2,1H3,(H,8,9).
What are the key properties of 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole?
4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 130.17 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-(fluoromethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 173379063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).