C7H12N2O — CID 173379083
4,5,6-trimethyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 173379083) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 4,5,6-trimethyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 4,5,6-trimethyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 173379083 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4,5,6-trimethyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CC1=C(C)C(C)NC(=O)N1 |
| InChI | InChI=1S/C7H12N2O/c1-4-5(2)8-7(10)9-6(4)3/h5H,1-3H3,(H2,8,9,10) |
| InChIKey | KSIIYMVMNCGLQO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |