C21H32O — CID 173379331
(Z)-3,8-dimethyl-1-phenyltridec-8-en-1-one (PubChem CID 173379331) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (Z)-3,8-dimethyl-1-phenyltridec-8-en-1-one.
| Compound Name | (Z)-3,8-dimethyl-1-phenyltridec-8-en-1-one |
|---|---|
| PubChem CID | 173379331 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (Z)-3,8-dimethyl-1-phenyltridec-8-en-1-one |
| SMILES | CCCC/C=C(/C)CCCCC(C)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H32O/c1-4-5-7-12-18(2)13-10-11-14-19(3)17-21(22)20-15-8-6-9-16-20/h6,8-9,12,15-16,19H,4-5,7,10-11,13-14,17H2,1-3H3/b18-12- |
| InChIKey | SUCBNHURYOUKMO-PDGQHHTCSA-N |
| XLogP | 6.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|