About magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride
magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride (PubChem CID 173379946) has the molecular formula C18H13ClMgN2
and a molecular weight of 317.07 g/mol. Its IUPAC name is magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride.
Molecular Properties
| Compound Name | magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride |
| PubChem CID | 173379946 |
| Molecular Formula | C18H13ClMgN2 |
| Molecular Weight | 317.07 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride |
| SMILES | N#Cc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C18H11ClN2.Mg.2H/c19-16-7-5-15-6-9-17(21-18(15)11-16)8-4-13-2-1-3-14(10-13)12-20;;;/h1-11H;;;/q;+2;2*-1/b8-4+;;; |
| InChIKey | QRGJELHLGAUKMC-SJKHGNCSSA-N |
| XLogP | 4.77 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.07 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride?
The IUPAC name of magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride (CID 173379946) is magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride.
What is the SMILES notation for magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride?
The canonical SMILES for magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride is N#Cc1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride?
The InChIKey is QRGJELHLGAUKMC-SJKHGNCSSA-N. The full InChI is InChI=1S/C18H11ClN2.Mg.2H/c19-16-7-5-15-6-9-17(21-18(15)11-16)8-4-13-2-1-3-14(10-13)12-20;;;/h1-11H;;;/q;+2;2*-1/b8-4+;;;.
What are the key properties of magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride?
magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride has a molecular weight of 317.07 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]benzonitrile;hydride is sourced from PubChem (CID 173379946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).