About CID 173380075
CID 173380075 (PubChem CID 173380075) has the molecular formula C11H14N4O4Si+
and a molecular weight of 294.34 g/mol.
Molecular Properties
| Compound Name | CID 173380075 |
| PubChem CID | 173380075 |
| Molecular Formula | C11H14N4O4Si+ |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | — |
| SMILES | CC[Si]1C2=[NH+]C3C(=O)N(C)C(=O)N(C3=N2)C1CC(=O)O |
| InChI | InChI=1S/C11H13N4O4Si/c1-3-20-5(4-6(16)17)15-8-7(12-10(20)13-8)9(18)14(2)11(15)19/h5,7H,3-4H2,1-2H3,(H,16,17)/p+1 |
| InChIKey | VDCRBHAVSQUUJE-UHFFFAOYSA-O |
| XLogP | -2.41 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173380075 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173380075?
The IUPAC name of CID 173380075 (CID 173380075) is not available.
What is the SMILES notation for CID 173380075?
The canonical SMILES for CID 173380075 is CC[Si]1C2=[NH+]C3C(=O)N(C)C(=O)N(C3=N2)C1CC(=O)O.
What is the InChIKey of CID 173380075?
The InChIKey is VDCRBHAVSQUUJE-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H13N4O4Si/c1-3-20-5(4-6(16)17)15-8-7(12-10(20)13-8)9(18)14(2)11(15)19/h5,7H,3-4H2,1-2H3,(H,16,17)/p+1.
What are the key properties of CID 173380075?
CID 173380075 has a molecular weight of 294.34 g/mol, XLogP of -2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173380075 is sourced from PubChem (CID 173380075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).