C22H30 — CID 173380316
[(2E,4E)-3,4-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienyl]benzene (PubChem CID 173380316) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is [(2E,4E)-3,4-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienyl]benzene.
| Compound Name | [(2E,4E)-3,4-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 173380316 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | [(2E,4E)-3,4-dimethyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dienyl]benzene |
| SMILES | CC1=CCCC(C)(C)C1/C=C(C)/C(C)=C/Cc1ccccc1 |
| InChI | InChI=1S/C22H30/c1-17(13-14-20-11-7-6-8-12-20)19(3)16-21-18(2)10-9-15-22(21,4)5/h6-8,10-13,16,21H,9,14-15H2,1-5H3/b17-13+,19-16+ |
| InChIKey | FZPIEGQTGKWZFL-KTSULJHRSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|