C15H21N3O6 — CID 173381575
(2,5-dioxopyrrolidin-1-yl) (2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 173381575) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 173381575 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCCCON1C(=O)N2C[C@H]1CC[C@H]2C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H21N3O6/c1-2-3-8-23-17-10-4-5-11(16(9-10)15(17)22)14(21)24-18-12(19)6-7-13(18)20/h10-11H,2-9H2,1H3/t10-,11+/m1/s1 |
| InChIKey | OPZNLFFCBRESCI-MNOVXSKESA-N |
| XLogP | 0.59 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|