C36H46N4O — CID 173381578
2,3,7,8,12,13,17,18-octaethyl-22,23-dihydro-21H-porphyrin-5-one (PubChem CID 173381578) has the molecular formula C36H46N4O and a molecular weight of 550.79 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-22,23-dihydro-21H-porphyrin-5-one.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-22,23-dihydro-21H-porphyrin-5-one |
|---|---|
| PubChem CID | 173381578 |
| Molecular Formula | C36H46N4O |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-22,23-dihydro-21H-porphyrin-5-one |
| SMILES | CCC1=C(CC)c2cc3[nH]c(c(CC)c3CC)c(=O)c3[nH]c(cc4[nH]c(cc1n2)c(CC)c4CC)c(CC)c3CC |
| InChI | InChI=1S/C36H46N4O/c1-9-20-22(11-3)30-18-32-24(13-5)26(15-7)34(39-32)36(41)35-27(16-8)25(14-6)33(40-35)19-31-23(12-4)21(10-2)29(38-31)17-28(20)37-30/h17-19,37,39-40H,9-16H2,1-8H3/b28-17-,30-18-,31-19- |
| InChIKey | RWQRDCMGIQMBFB-HKZHYHJHSA-N |
| XLogP | 8.99 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |