About (6R)-6-methyl-6-nitro-1,5-dihydroindazole
(6R)-6-methyl-6-nitro-1,5-dihydroindazole (PubChem CID 173381827) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is (6R)-6-methyl-6-nitro-1,5-dihydroindazole.
Molecular Properties
| Compound Name | (6R)-6-methyl-6-nitro-1,5-dihydroindazole |
| PubChem CID | 173381827 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (6R)-6-methyl-6-nitro-1,5-dihydroindazole |
| SMILES | C[C@]1([N+](=O)[O-])C=c2[nH]ncc2=CC1 |
| InChI | InChI=1S/C8H9N3O2/c1-8(11(12)13)3-2-6-5-9-10-7(6)4-8/h2,4-5,10H,3H2,1H3/t8-/m1/s1 |
| InChIKey | YNCGKUICZJYKFJ-MRVPVSSYSA-N |
| XLogP | -0.59 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6R)-6-methyl-6-nitro-1,5-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-methyl-6-nitro-1,5-dihydroindazole?
The IUPAC name of (6R)-6-methyl-6-nitro-1,5-dihydroindazole (CID 173381827) is (6R)-6-methyl-6-nitro-1,5-dihydroindazole.
What is the SMILES notation for (6R)-6-methyl-6-nitro-1,5-dihydroindazole?
The canonical SMILES for (6R)-6-methyl-6-nitro-1,5-dihydroindazole is C[C@]1([N+](=O)[O-])C=c2[nH]ncc2=CC1.
What is the InChIKey of (6R)-6-methyl-6-nitro-1,5-dihydroindazole?
The InChIKey is YNCGKUICZJYKFJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-8(11(12)13)3-2-6-5-9-10-7(6)4-8/h2,4-5,10H,3H2,1H3/t8-/m1/s1.
What are the key properties of (6R)-6-methyl-6-nitro-1,5-dihydroindazole?
(6R)-6-methyl-6-nitro-1,5-dihydroindazole has a molecular weight of 179.18 g/mol, XLogP of -0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-methyl-6-nitro-1,5-dihydroindazole is sourced from PubChem (CID 173381827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).