C10H17N5O3 — CID 173382658
2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetaldehyde (PubChem CID 173382658) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetaldehyde.
| Compound Name | 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetaldehyde |
|---|---|
| PubChem CID | 173382658 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetaldehyde |
| SMILES | [H]/N=C1\NC(=O)N(CCN(C)C)C(=O)C1NCC=O |
| InChI | InChI=1S/C10H17N5O3/c1-14(2)4-5-15-9(17)7(12-3-6-16)8(11)13-10(15)18/h6-7,12H,3-5H2,1-2H3,(H2,11,13,18) |
| InChIKey | MCGCYQVSGJQTMM-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|