About (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan
(3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan (PubChem CID 173382775) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan.
Molecular Properties
| Compound Name | (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan |
| PubChem CID | 173382775 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan |
| SMILES | CCCCS[C@@]1(C)C=C(C)OC1C |
| InChI | InChI=1S/C11H20OS/c1-5-6-7-13-11(4)8-9(2)12-10(11)3/h8,10H,5-7H2,1-4H3/t10?,11-/m0/s1 |
| InChIKey | LDTQHKMUECKTQF-DTIOYNMSSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan?
The IUPAC name of (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan (CID 173382775) is (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan.
What is the SMILES notation for (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan?
The canonical SMILES for (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan is CCCCS[C@@]1(C)C=C(C)OC1C.
What is the InChIKey of (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan?
The InChIKey is LDTQHKMUECKTQF-DTIOYNMSSA-N. The full InChI is InChI=1S/C11H20OS/c1-5-6-7-13-11(4)8-9(2)12-10(11)3/h8,10H,5-7H2,1-4H3/t10?,11-/m0/s1.
What are the key properties of (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan?
(3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan has a molecular weight of 200.35 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-butylsulfanyl-2,3,5-trimethyl-2H-furan is sourced from PubChem (CID 173382775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).