C16H4F10OS — CID 173382865
1-[2-[1,2-difluoro-2-(2,3,4-trifluorophenyl)ethenyl]sulfinyl-1,2-difluoroethenyl]-2,3,4-trifluorobenzene (PubChem CID 173382865) has the molecular formula C16H4F10OS and a molecular weight of 434.25 g/mol. Its IUPAC name is 1-[2-[1,2-difluoro-2-(2,3,4-trifluorophenyl)ethenyl]sulfinyl-1,2-difluoroethenyl]-2,3,4-trifluorobenzene.
| Compound Name | 1-[2-[1,2-difluoro-2-(2,3,4-trifluorophenyl)ethenyl]sulfinyl-1,2-difluoroethenyl]-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 173382865 |
| Molecular Formula | C16H4F10OS |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | 1-[2-[1,2-difluoro-2-(2,3,4-trifluorophenyl)ethenyl]sulfinyl-1,2-difluoroethenyl]-2,3,4-trifluorobenzene |
| SMILES | O=S(C(F)=C(F)c1ccc(F)c(F)c1F)C(F)=C(F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H4F10OS/c17-7-3-1-5(9(19)13(7)23)11(21)15(25)28(27)16(26)12(22)6-2-4-8(18)14(24)10(6)20/h1-4H |
| InChIKey | ZTTMOPUUTSPVTL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|