C31H34O6S — CID 173382925
[(1S,4S,5S,6R,9S,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylthiophene-2-carboxylate (PubChem CID 173382925) has the molecular formula C31H34O6S and a molecular weight of 534.67 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylthiophene-2-carboxylate.
| Compound Name | [(1S,4S,5S,6R,9S,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 173382925 |
| Molecular Formula | C31H34O6S |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [(1S,4S,5S,6R,9S,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 3-phenylthiophene-2-carboxylate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1sccc1-c1ccccc1)C1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C31H34O6S/c1-16-14-30-17(2)12-22-23(29(22,3)4)21(26(30)34)13-19(15-32)25(33)31(30,36)27(16)37-28(35)24-20(10-11-38-24)18-8-6-5-7-9-18/h5-11,13-14,17,21-23,25,27,32-33,36H,12,15H2,1-4H3/t17-,21+,22-,23?,25-,27+,30+,31+/m1/s1 |
| InChIKey | ZKZOBVNMAKMCSH-PYJDXZPSSA-N |
| XLogP | 4.41 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|