About (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine
(Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine (PubChem CID 173383045) has the molecular formula C8H13F2N3
and a molecular weight of 189.21 g/mol. Its IUPAC name is (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine |
| PubChem CID | 173383045 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine |
| SMILES | C=C(N=C/C(C)=C\N)NCC(F)F |
| InChI | InChI=1S/C8H13F2N3/c1-6(3-11)4-12-7(2)13-5-8(9)10/h3-4,8,13H,2,5,11H2,1H3/b6-3-,12-4? |
| InChIKey | DAWSSQLPDGAAQE-HMIHQJSXSA-N |
| XLogP | 1.25 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine?
The IUPAC name of (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine (CID 173383045) is (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine.
What is the SMILES notation for (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine?
The canonical SMILES for (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine is C=C(N=C/C(C)=C\N)NCC(F)F.
What is the InChIKey of (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine?
The InChIKey is DAWSSQLPDGAAQE-HMIHQJSXSA-N. The full InChI is InChI=1S/C8H13F2N3/c1-6(3-11)4-12-7(2)13-5-8(9)10/h3-4,8,13H,2,5,11H2,1H3/b6-3-,12-4?.
What are the key properties of (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine?
(Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine has a molecular weight of 189.21 g/mol, XLogP of 1.25, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[1-(2,2-difluoroethylamino)ethenylimino]-2-methylprop-1-en-1-amine is sourced from PubChem (CID 173383045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).