C21H23ClFIN8 — CID 173383080
5-chloro-N'-[(E)-2-fluoro-3-iodo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]prop-1-enyl]-1H-pyrrolo[2,3-b]pyridine-3-carboximidamide (PubChem CID 173383080) has the molecular formula C21H23ClFIN8 and a molecular weight of 568.83 g/mol. Its IUPAC name is 5-chloro-N'-[(E)-2-fluoro-3-iodo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]prop-1-enyl]-1H-pyrrolo[2,3-b]pyridine-3-carboximidamide.
| Compound Name | 5-chloro-N'-[(E)-2-fluoro-3-iodo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]prop-1-enyl]-1H-pyrrolo[2,3-b]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 173383080 |
| Molecular Formula | C21H23ClFIN8 |
| Molecular Weight | 568.83 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 5-chloro-N'-[(E)-2-fluoro-3-iodo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methylamino]prop-1-enyl]-1H-pyrrolo[2,3-b]pyridine-3-carboximidamide |
| SMILES | NC(=N/C(NC[C@H]1CCCN(c2ncccn2)C1)=C(/F)CI)c1c[nH]c2ncc(Cl)cc12 |
| InChI | InChI=1S/C21H23ClFIN8/c22-14-7-15-16(11-30-19(15)29-10-14)18(25)31-20(17(23)8-24)28-9-13-3-1-6-32(12-13)21-26-4-2-5-27-21/h2,4-5,7,10-11,13,28H,1,3,6,8-9,12H2,(H2,25,31)(H,29,30)/b20-17+/t13-/m1/s1 |
| InChIKey | GQYWAALWGSLPNN-HZDTVXMRSA-N |
| XLogP | 3.79 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|