About (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane
(2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane (PubChem CID 173383727) has the molecular formula C32H30Si
and a molecular weight of 442.68 g/mol. Its IUPAC name is (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane.
Molecular Properties
| Compound Name | (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane |
| PubChem CID | 173383727 |
| Molecular Formula | C32H30Si |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane |
| SMILES | Cc1cc(C)cc([Si](C2=C(Cc3ccccc3)C=CC2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H30Si/c1-25-21-26(2)23-31(22-25)33(29-16-8-4-9-17-29,30-18-10-5-11-19-30)32-20-12-15-28(32)24-27-13-6-3-7-14-27/h3-19,21-23H,20,24H2,1-2H3 |
| InChIKey | VBTKXJUTVCPWQR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane?
The IUPAC name of (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane (CID 173383727) is (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane.
What is the SMILES notation for (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane?
The canonical SMILES for (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane is Cc1cc(C)cc([Si](C2=C(Cc3ccccc3)C=CC2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane?
The InChIKey is VBTKXJUTVCPWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H30Si/c1-25-21-26(2)23-31(22-25)33(29-16-8-4-9-17-29,30-18-10-5-11-19-30)32-20-12-15-28(32)24-27-13-6-3-7-14-27/h3-19,21-23H,20,24H2,1-2H3.
What are the key properties of (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane?
(2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane has a molecular weight of 442.68 g/mol, XLogP of 5.81, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzylcyclopenta-1,3-dien-1-yl)-(3,5-dimethylphenyl)-diphenylsilane is sourced from PubChem (CID 173383727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).