About N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine
N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 17338435) has the molecular formula C17H20N2O2S
and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 17338435 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | COc1ccccc1CN(Cc1ccco1)C1=NCCCS1 |
| InChI | InChI=1S/C17H20N2O2S/c1-20-16-8-3-2-6-14(16)12-19(13-15-7-4-10-21-15)17-18-9-5-11-22-17/h2-4,6-8,10H,5,9,11-13H2,1H3 |
| InChIKey | DGNZINBDUVDHIB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 17338435) is N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine is COc1ccccc1CN(Cc1ccco1)C1=NCCCS1.
What is the InChIKey of N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is DGNZINBDUVDHIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2S/c1-20-16-8-3-2-6-14(16)12-19(13-15-7-4-10-21-15)17-18-9-5-11-22-17/h2-4,6-8,10H,5,9,11-13H2,1H3.
What are the key properties of N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 316.43 g/mol, XLogP of 3.78, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-N-[(2-methoxyphenyl)methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 17338435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).