C19H28Si — CID 173385104
(4-pentylcyclopenta-1,4-dien-1-yl)-(2,4,6-trimethylphenyl)silane (PubChem CID 173385104) has the molecular formula C19H28Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (4-pentylcyclopenta-1,4-dien-1-yl)-(2,4,6-trimethylphenyl)silane.
| Compound Name | (4-pentylcyclopenta-1,4-dien-1-yl)-(2,4,6-trimethylphenyl)silane |
|---|---|
| PubChem CID | 173385104 |
| Molecular Formula | C19H28Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (4-pentylcyclopenta-1,4-dien-1-yl)-(2,4,6-trimethylphenyl)silane |
| SMILES | CCCCCC1=CC([SiH2]c2c(C)cc(C)cc2C)=CC1 |
| InChI | InChI=1S/C19H28Si/c1-5-6-7-8-17-9-10-18(13-17)20-19-15(3)11-14(2)12-16(19)4/h10-13H,5-9,20H2,1-4H3 |
| InChIKey | ZIYRJOYAMMWVPK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|