About anthracene;silirane
anthracene;silirane (PubChem CID 173385218) has the molecular formula C16H16Si
and a molecular weight of 236.39 g/mol. Its IUPAC name is anthracene;silirane.
Molecular Properties
| Compound Name | anthracene;silirane |
| PubChem CID | 173385218 |
| Molecular Formula | C16H16Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | anthracene;silirane |
| SMILES | C1C[SiH2]1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C2H6Si/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-3-1/h1-10H;1-3H2 |
| InChIKey | WRFIMGQCDFHRIC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;silirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;silirane?
The IUPAC name of anthracene;silirane (CID 173385218) is anthracene;silirane.
What is the SMILES notation for anthracene;silirane?
The canonical SMILES for anthracene;silirane is C1C[SiH2]1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;silirane?
The InChIKey is WRFIMGQCDFHRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C2H6Si/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-3-1/h1-10H;1-3H2.
What are the key properties of anthracene;silirane?
anthracene;silirane has a molecular weight of 236.39 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;silirane is sourced from PubChem (CID 173385218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).