C15H17Cl3Ti — CID 173385235
2-(cyclopenta-1,3-dien-1-ylmethyl)-1,3,4-trimethylbenzene;titanium(4+);trichloride (PubChem CID 173385235) has the molecular formula C15H17Cl3Ti and a molecular weight of 351.53 g/mol. Its IUPAC name is 2-(cyclopenta-1,3-dien-1-ylmethyl)-1,3,4-trimethylbenzene;titanium(4+);trichloride.
| Compound Name | 2-(cyclopenta-1,3-dien-1-ylmethyl)-1,3,4-trimethylbenzene;titanium(4+);trichloride |
|---|---|
| PubChem CID | 173385235 |
| Molecular Formula | C15H17Cl3Ti |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-(cyclopenta-1,3-dien-1-ylmethyl)-1,3,4-trimethylbenzene;titanium(4+);trichloride |
| SMILES | Cc1ccc(C)c(CC2=[C-]C=CC2)c1C.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C15H17.3ClH.Ti/c1-11-8-9-12(2)15(13(11)3)10-14-6-4-5-7-14;;;;/h4-5,8-9H,6,10H2,1-3H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | IAOBVJUBUXWCJB-UHFFFAOYSA-K |
| XLogP | -5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | -5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|