About N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine
N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 17338529) has the molecular formula C17H18FN3S
and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 17338529 |
| Molecular Formula | C17H18FN3S |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | Fc1cccc(CN(Cc2cccnc2)C2=NCCCS2)c1 |
| InChI | InChI=1S/C17H18FN3S/c18-16-6-1-4-14(10-16)12-21(17-20-8-3-9-22-17)13-15-5-2-7-19-11-15/h1-2,4-7,10-11H,3,8-9,12-13H2 |
| InChIKey | OZCRVZRRCNCSGL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 17338529) is N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is Fc1cccc(CN(Cc2cccnc2)C2=NCCCS2)c1.
What is the InChIKey of N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is OZCRVZRRCNCSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3S/c18-16-6-1-4-14(10-16)12-21(17-20-8-3-9-22-17)13-15-5-2-7-19-11-15/h1-2,4-7,10-11H,3,8-9,12-13H2.
What are the key properties of N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 315.42 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluorophenyl)methyl]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 17338529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).