C9H13NO5S2 — CID 173385405
3-(2-sulfamoylphenyl)propane-1-sulfonic acid (PubChem CID 173385405) has the molecular formula C9H13NO5S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(2-sulfamoylphenyl)propane-1-sulfonic acid.
| Compound Name | 3-(2-sulfamoylphenyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173385405 |
| Molecular Formula | C9H13NO5S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 3-(2-sulfamoylphenyl)propane-1-sulfonic acid |
| SMILES | NS(=O)(=O)c1ccccc1CCCS(=O)(=O)O |
| InChI | InChI=1S/C9H13NO5S2/c10-17(14,15)9-6-2-1-4-8(9)5-3-7-16(11,12)13/h1-2,4,6H,3,5,7H2,(H2,10,14,15)(H,11,12,13) |
| InChIKey | RGZUSKXVQFRFER-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|