C66H120O6 — CID 173386211
2-(2-octadec-9-enoyl-4-oxo-3-pentadec-6-enylhenicos-12-enoyl)oxydodecanoic acid (PubChem CID 173386211) has the molecular formula C66H120O6 and a molecular weight of 1009.68 g/mol. Its IUPAC name is 2-(2-octadec-9-enoyl-4-oxo-3-pentadec-6-enylhenicos-12-enoyl)oxydodecanoic acid.
| Compound Name | 2-(2-octadec-9-enoyl-4-oxo-3-pentadec-6-enylhenicos-12-enoyl)oxydodecanoic acid |
|---|---|
| PubChem CID | 173386211 |
| Molecular Formula | C66H120O6 |
| Molecular Weight | 1009.68 g/mol |
| Exact Mass | 1008.91 |
| IUPAC Name | 2-(2-octadec-9-enoyl-4-oxo-3-pentadec-6-enylhenicos-12-enoyl)oxydodecanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(CCCCCC=CCCCCCCCC)C(C(=O)CCCCCCCC=CCCCCCCCC)C(=O)OC(CCCCCCCCCC)C(=O)O |
| InChI | InChI=1S/C66H120O6/c1-5-9-13-17-21-25-28-31-33-36-39-42-45-49-53-57-61(67)60(56-52-48-44-41-38-35-30-27-23-19-15-11-7-3)64(66(71)72-63(65(69)70)59-55-51-47-24-20-16-12-8-4)62(68)58-54-50-46-43-40-37-34-32-29-26-22-18-14-10-6-2/h31-35,38,60,63-64H,5-30,36-37,39-59H2,1-4H3,(H,69,70) |
| InChIKey | ROZDCMHYYOOIKK-UHFFFAOYSA-N |
| XLogP | 21.22 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.68 |
| LogP ≤ 5 | 21.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|