silver;azanide;benzotriazole-3a-carboxylic acid

C7H7AgN4O2 — CID 173386433

IUPACsilver;azanide;benzotriazole-3a-carboxylic acid
SMILESO=C(O)C12C=CC=CC1=NN=N2.[Ag+].[NH2-]
InChIInChI=1S/C7H5N3O2.Ag.H2N/c11-6(12)7-4-2-1-3-5(7)8-10-9-7;;/h1-4H,(H,11,12);;1H2/q;+1;-1
InChIKeyOXZBVDSDQWEMQX-UHFFFAOYSA-N
MW287.03 g/mol
LogP1.47
Rot. Bonds1

About silver;azanide;benzotriazole-3a-carboxylic acid

silver;azanide;benzotriazole-3a-carboxylic acid (PubChem CID 173386433) has the molecular formula C7H7AgN4O2 and a molecular weight of 287.03 g/mol. Its IUPAC name is silver;azanide;benzotriazole-3a-carboxylic acid.

Molecular Properties

Compound Namesilver;azanide;benzotriazole-3a-carboxylic acid
PubChem CID173386433
Molecular FormulaC7H7AgN4O2
Molecular Weight287.03 g/mol
Exact Mass285.96
IUPAC Namesilver;azanide;benzotriazole-3a-carboxylic acid
SMILESO=C(O)C12C=CC=CC1=NN=N2.[Ag+].[NH2-]
InChIInChI=1S/C7H5N3O2.Ag.H2N/c11-6(12)7-4-2-1-3-5(7)8-10-9-7;;/h1-4H,(H,11,12);;1H2/q;+1;-1
InChIKeyOXZBVDSDQWEMQX-UHFFFAOYSA-N
XLogP1.47
TPSA107.88 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.03
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze silver;azanide;benzotriazole-3a-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of silver;azanide;benzotriazole-3a-carboxylic acid?
The IUPAC name of silver;azanide;benzotriazole-3a-carboxylic acid (CID 173386433) is silver;azanide;benzotriazole-3a-carboxylic acid.
What is the SMILES notation for silver;azanide;benzotriazole-3a-carboxylic acid?
The canonical SMILES for silver;azanide;benzotriazole-3a-carboxylic acid is O=C(O)C12C=CC=CC1=NN=N2.[Ag+].[NH2-].
What is the InChIKey of silver;azanide;benzotriazole-3a-carboxylic acid?
The InChIKey is OXZBVDSDQWEMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2.Ag.H2N/c11-6(12)7-4-2-1-3-5(7)8-10-9-7;;/h1-4H,(H,11,12);;1H2/q;+1;-1.
What are the key properties of silver;azanide;benzotriazole-3a-carboxylic acid?
silver;azanide;benzotriazole-3a-carboxylic acid has a molecular weight of 287.03 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;azanide;benzotriazole-3a-carboxylic acid is sourced from PubChem (CID 173386433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).