About silver;azanide;benzotriazole-3a-carboxylic acid
silver;azanide;benzotriazole-3a-carboxylic acid (PubChem CID 173386433) has the molecular formula C7H7AgN4O2
and a molecular weight of 287.03 g/mol. Its IUPAC name is silver;azanide;benzotriazole-3a-carboxylic acid.
Molecular Properties
| Compound Name | silver;azanide;benzotriazole-3a-carboxylic acid |
| PubChem CID | 173386433 |
| Molecular Formula | C7H7AgN4O2 |
| Molecular Weight | 287.03 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | silver;azanide;benzotriazole-3a-carboxylic acid |
| SMILES | O=C(O)C12C=CC=CC1=NN=N2.[Ag+].[NH2-] |
| InChI | InChI=1S/C7H5N3O2.Ag.H2N/c11-6(12)7-4-2-1-3-5(7)8-10-9-7;;/h1-4H,(H,11,12);;1H2/q;+1;-1 |
| InChIKey | OXZBVDSDQWEMQX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.03 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze silver;azanide;benzotriazole-3a-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;azanide;benzotriazole-3a-carboxylic acid?
The IUPAC name of silver;azanide;benzotriazole-3a-carboxylic acid (CID 173386433) is silver;azanide;benzotriazole-3a-carboxylic acid.
What is the SMILES notation for silver;azanide;benzotriazole-3a-carboxylic acid?
The canonical SMILES for silver;azanide;benzotriazole-3a-carboxylic acid is O=C(O)C12C=CC=CC1=NN=N2.[Ag+].[NH2-].
What is the InChIKey of silver;azanide;benzotriazole-3a-carboxylic acid?
The InChIKey is OXZBVDSDQWEMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2.Ag.H2N/c11-6(12)7-4-2-1-3-5(7)8-10-9-7;;/h1-4H,(H,11,12);;1H2/q;+1;-1.
What are the key properties of silver;azanide;benzotriazole-3a-carboxylic acid?
silver;azanide;benzotriazole-3a-carboxylic acid has a molecular weight of 287.03 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;azanide;benzotriazole-3a-carboxylic acid is sourced from PubChem (CID 173386433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).