C12H18O4 — CID 173386708
2-methylbut-3-en-2-yl 1-hydroperoxycyclohex-2-ene-1-carboxylate (PubChem CID 173386708) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl 1-hydroperoxycyclohex-2-ene-1-carboxylate.
| Compound Name | 2-methylbut-3-en-2-yl 1-hydroperoxycyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 173386708 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-methylbut-3-en-2-yl 1-hydroperoxycyclohex-2-ene-1-carboxylate |
| SMILES | C=CC(C)(C)OC(=O)C1(OO)C=CCCC1 |
| InChI | InChI=1S/C12H18O4/c1-4-11(2,3)15-10(13)12(16-14)8-6-5-7-9-12/h4,6,8,14H,1,5,7,9H2,2-3H3 |
| InChIKey | WUHCUEVIXPVKJS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|