About N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine
N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 17338702) has the molecular formula C14H18N2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 17338702 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | C=CCN(Cc1ccccc1)C1=NCCCS1 |
| InChI | InChI=1S/C14H18N2S/c1-2-10-16(14-15-9-6-11-17-14)12-13-7-4-3-5-8-13/h2-5,7-8H,1,6,9-12H2 |
| InChIKey | VQQLFHQPNYRZDC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 17338702) is N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine is C=CCN(Cc1ccccc1)C1=NCCCS1.
What is the InChIKey of N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is VQQLFHQPNYRZDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S/c1-2-10-16(14-15-9-6-11-17-14)12-13-7-4-3-5-8-13/h2-5,7-8H,1,6,9-12H2.
What are the key properties of N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 246.38 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-prop-2-enyl-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 17338702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).