C17H20NNaO8S2 — CID 173387108
sodium;hydride;4-[4-(prop-2-enoylamino)butoxy]naphthalene-2,7-disulfonic acid (PubChem CID 173387108) has the molecular formula C17H20NNaO8S2 and a molecular weight of 453.47 g/mol. Its IUPAC name is sodium;hydride;4-[4-(prop-2-enoylamino)butoxy]naphthalene-2,7-disulfonic acid.
| Compound Name | sodium;hydride;4-[4-(prop-2-enoylamino)butoxy]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 173387108 |
| Molecular Formula | C17H20NNaO8S2 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | sodium;hydride;4-[4-(prop-2-enoylamino)butoxy]naphthalene-2,7-disulfonic acid |
| SMILES | C=CC(=O)NCCCCOc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc12.[H-].[Na+] |
| InChI | InChI=1S/C17H19NO8S2.Na.H/c1-2-17(19)18-7-3-4-8-26-16-11-14(28(23,24)25)10-12-9-13(27(20,21)22)5-6-15(12)16;;/h2,5-6,9-11H,1,3-4,7-8H2,(H,18,19)(H,20,21,22)(H,23,24,25);;/q;+1;-1 |
| InChIKey | AJTHWFXYMFHIPL-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|