C21H22NNaO3S — CID 173387212
sodium;5-[(2,2-dimethyl-3-phenyl-3,4-dihydrochromen-6-yl)methyl]-1,3-thiazolidine-2,4-dione;hydride (PubChem CID 173387212) has the molecular formula C21H22NNaO3S and a molecular weight of 391.47 g/mol. Its IUPAC name is sodium;5-[(2,2-dimethyl-3-phenyl-3,4-dihydrochromen-6-yl)methyl]-1,3-thiazolidine-2,4-dione;hydride.
| Compound Name | sodium;5-[(2,2-dimethyl-3-phenyl-3,4-dihydrochromen-6-yl)methyl]-1,3-thiazolidine-2,4-dione;hydride |
|---|---|
| PubChem CID | 173387212 |
| Molecular Formula | C21H22NNaO3S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | sodium;5-[(2,2-dimethyl-3-phenyl-3,4-dihydrochromen-6-yl)methyl]-1,3-thiazolidine-2,4-dione;hydride |
| SMILES | CC1(C)Oc2ccc(CC3SC(=O)NC3=O)cc2CC1c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C21H21NO3S.Na.H/c1-21(2)16(14-6-4-3-5-7-14)12-15-10-13(8-9-17(15)25-21)11-18-19(23)22-20(24)26-18;;/h3-10,16,18H,11-12H2,1-2H3,(H,22,23,24);;/q;+1;-1 |
| InChIKey | COINPZZNGNKPPJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|