About acetic acid;(dichloromethane);methanol
acetic acid;(dichloromethane);methanol (PubChem CID 173388034) has the molecular formula C101H214Cl186O8
and a molecular weight of 8151.07 g/mol. Its IUPAC name is acetic acid;(dichloromethane);methanol.
Molecular Properties
| Compound Name | acetic acid;(dichloromethane);methanol |
| PubChem CID | 173388034 |
| Molecular Formula | C101H214Cl186O8 |
| Molecular Weight | 8151.07 g/mol |
| Exact Mass | 8059.84 |
| IUPAC Name | acetic acid;(dichloromethane);methanol |
| SMILES | CC(=O)O.CO.CO.CO.CO.CO.CO.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl |
| InChI | InChI=1S/C2H4O2.93CH2Cl2.6CH4O/c1-2(3)4;93*2-1-3;6*1-2/h1H3,(H,3,4);93*1H2;6*2H,1H3 |
| InChIKey | DQFOQDMLSNNTQK-UHFFFAOYSA-N |
| XLogP | 129.94 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 295 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 8151.07 |
| LogP ≤ 5 | 129.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze acetic acid;(dichloromethane);methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(dichloromethane);methanol?
The IUPAC name of acetic acid;(dichloromethane);methanol (CID 173388034) is acetic acid;(dichloromethane);methanol.
What is the SMILES notation for acetic acid;(dichloromethane);methanol?
The canonical SMILES for acetic acid;(dichloromethane);methanol is CC(=O)O.CO.CO.CO.CO.CO.CO.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.
What is the InChIKey of acetic acid;(dichloromethane);methanol?
The InChIKey is DQFOQDMLSNNTQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.93CH2Cl2.6CH4O/c1-2(3)4;93*2-1-3;6*1-2/h1H3,(H,3,4);93*1H2;6*2H,1H3.
What are the key properties of acetic acid;(dichloromethane);methanol?
acetic acid;(dichloromethane);methanol has a molecular weight of 8151.07 g/mol, XLogP of 129.94, 0 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(dichloromethane);methanol is sourced from PubChem (CID 173388034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).