About 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine
2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine (PubChem CID 173388131) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine |
| PubChem CID | 173388131 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine |
| SMILES | [H]/N=N/c1ncccc1N(CC=C)CC=C |
| InChI | InChI=1S/C11H14N4/c1-3-8-15(9-4-2)10-6-5-7-13-11(10)14-12/h3-7,12H,1-2,8-9H2/b14-12+ |
| InChIKey | CATOYHKWNODYOQ-WYMLVPIESA-N |
| XLogP | 2.92 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine?
The IUPAC name of 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine (CID 173388131) is 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine.
What is the SMILES notation for 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine?
The canonical SMILES for 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine is [H]/N=N/c1ncccc1N(CC=C)CC=C.
What is the InChIKey of 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine?
The InChIKey is CATOYHKWNODYOQ-WYMLVPIESA-N. The full InChI is InChI=1S/C11H14N4/c1-3-8-15(9-4-2)10-6-5-7-13-11(10)14-12/h3-7,12H,1-2,8-9H2/b14-12+.
What are the key properties of 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine?
2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine has a molecular weight of 202.26 g/mol, XLogP of 2.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenyl-N,N-bis(prop-2-enyl)pyridin-3-amine is sourced from PubChem (CID 173388131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).