dihydroxyphosphanylphosphonous acid;phosphorous acid

H7O7P3 — CID 173388765

IUPACdihydroxyphosphanylphosphonous acid;phosphorous acid
SMILESOP(O)O.OP(O)P(O)O
InChIInChI=1S/H4O4P2.H3O3P/c1-5(2)6(3)4;1-4(2)3/h1-4H;1-3H
InChIKeyGQGYZVQDCTWENN-UHFFFAOYSA-N
MW211.97 g/mol
LogP-1.32
Rot. Bonds1

About dihydroxyphosphanylphosphonous acid;phosphorous acid

dihydroxyphosphanylphosphonous acid;phosphorous acid (PubChem CID 173388765) has the molecular formula H7O7P3 and a molecular weight of 211.97 g/mol. Its IUPAC name is dihydroxyphosphanylphosphonous acid;phosphorous acid.

Molecular Properties

Compound Namedihydroxyphosphanylphosphonous acid;phosphorous acid
PubChem CID173388765
Molecular FormulaH7O7P3
Molecular Weight211.97 g/mol
Exact Mass211.94
IUPAC Namedihydroxyphosphanylphosphonous acid;phosphorous acid
SMILESOP(O)O.OP(O)P(O)O
InChIInChI=1S/H4O4P2.H3O3P/c1-5(2)6(3)4;1-4(2)3/h1-4H;1-3H
InChIKeyGQGYZVQDCTWENN-UHFFFAOYSA-N
XLogP-1.32
TPSA141.61 Ų
H-Bond Donors7
H-Bond Acceptors7
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500211.97
LogP ≤ 5-1.32
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dihydroxyphosphanylphosphonous acid;phosphorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dihydroxyphosphanylphosphonous acid;phosphorous acid?
The IUPAC name of dihydroxyphosphanylphosphonous acid;phosphorous acid (CID 173388765) is dihydroxyphosphanylphosphonous acid;phosphorous acid.
What is the SMILES notation for dihydroxyphosphanylphosphonous acid;phosphorous acid?
The canonical SMILES for dihydroxyphosphanylphosphonous acid;phosphorous acid is OP(O)O.OP(O)P(O)O.
What is the InChIKey of dihydroxyphosphanylphosphonous acid;phosphorous acid?
The InChIKey is GQGYZVQDCTWENN-UHFFFAOYSA-N. The full InChI is InChI=1S/H4O4P2.H3O3P/c1-5(2)6(3)4;1-4(2)3/h1-4H;1-3H.
What are the key properties of dihydroxyphosphanylphosphonous acid;phosphorous acid?
dihydroxyphosphanylphosphonous acid;phosphorous acid has a molecular weight of 211.97 g/mol, XLogP of -1.32, 1 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxyphosphanylphosphonous acid;phosphorous acid is sourced from PubChem (CID 173388765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).