C8H11N3O3S — CID 173388857
2-amino-3-[2-(2-oxoethylsulfanyl)-1H-imidazol-5-yl]propanoic acid (PubChem CID 173388857) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-amino-3-[2-(2-oxoethylsulfanyl)-1H-imidazol-5-yl]propanoic acid.
| Compound Name | 2-amino-3-[2-(2-oxoethylsulfanyl)-1H-imidazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 173388857 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-amino-3-[2-(2-oxoethylsulfanyl)-1H-imidazol-5-yl]propanoic acid |
| SMILES | NC(Cc1cnc(SCC=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C8H11N3O3S/c9-6(7(13)14)3-5-4-10-8(11-5)15-2-1-12/h1,4,6H,2-3,9H2,(H,10,11)(H,13,14) |
| InChIKey | ZCWIQYFTEYOCKQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|