About [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid
[3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid (PubChem CID 173389263) has the molecular formula C13H33O5PSi3
and a molecular weight of 384.63 g/mol. Its IUPAC name is [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid.
Molecular Properties
| Compound Name | [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid |
| PubChem CID | 173389263 |
| Molecular Formula | C13H33O5PSi3 |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid |
| SMILES | COC(=CC([Si](C)(C)C)([Si](C)(C)C)P(=O)(O)O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H33O5PSi3/c1-17-12(18-22(8,9)10)11-13(19(14,15)16,20(2,3)4)21(5,6)7/h11H,1-10H3,(H2,14,15,16) |
| InChIKey | SSHXEJNFZYMNRV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid?
The IUPAC name of [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid (CID 173389263) is [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid.
What is the SMILES notation for [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid?
The canonical SMILES for [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid is COC(=CC([Si](C)(C)C)([Si](C)(C)C)P(=O)(O)O)O[Si](C)(C)C.
What is the InChIKey of [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid?
The InChIKey is SSHXEJNFZYMNRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H33O5PSi3/c1-17-12(18-22(8,9)10)11-13(19(14,15)16,20(2,3)4)21(5,6)7/h11H,1-10H3,(H2,14,15,16).
What are the key properties of [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid?
[3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid has a molecular weight of 384.63 g/mol, XLogP of 4.00, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methoxy-1,1-bis(trimethylsilyl)-3-trimethylsilyloxyprop-2-enyl]phosphonic acid is sourced from PubChem (CID 173389263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).