C10H22Cl2N2NaO5PS2 — CID 173389303
sodium;3-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]propane-1-sulfonic acid;hydride (PubChem CID 173389303) has the molecular formula C10H22Cl2N2NaO5PS2 and a molecular weight of 439.30 g/mol. Its IUPAC name is sodium;3-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]propane-1-sulfonic acid;hydride.
| Compound Name | sodium;3-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]propane-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173389303 |
| Molecular Formula | C10H22Cl2N2NaO5PS2 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | sodium;3-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]propane-1-sulfonic acid;hydride |
| SMILES | O=P1(N(CCCl)CCCl)NC(SCCCS(=O)(=O)O)CCO1.[H-].[Na+] |
| InChI | InChI=1S/C10H21Cl2N2O5PS2.Na.H/c11-3-5-14(6-4-12)20(15)13-10(2-7-19-20)21-8-1-9-22(16,17)18;;/h10H,1-9H2,(H,13,15)(H,16,17,18);;/q;+1;-1 |
| InChIKey | QYSNUPOEJPQYAM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|