C21H32N4S2 — CID 173389581
[4-(5-butylpyrimidin-2-yl)phenyl]carbamodithioic acid;N,N-diethylethanamine (PubChem CID 173389581) has the molecular formula C21H32N4S2 and a molecular weight of 404.65 g/mol. Its IUPAC name is [4-(5-butylpyrimidin-2-yl)phenyl]carbamodithioic acid;N,N-diethylethanamine.
| Compound Name | [4-(5-butylpyrimidin-2-yl)phenyl]carbamodithioic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 173389581 |
| Molecular Formula | C21H32N4S2 |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [4-(5-butylpyrimidin-2-yl)phenyl]carbamodithioic acid;N,N-diethylethanamine |
| SMILES | CCCCc1cnc(-c2ccc(NC(=S)S)cc2)nc1.CCN(CC)CC |
| InChI | InChI=1S/C15H17N3S2.C6H15N/c1-2-3-4-11-9-16-14(17-10-11)12-5-7-13(8-6-12)18-15(19)20;1-4-7(5-2)6-3/h5-10H,2-4H2,1H3,(H2,18,19,20);4-6H2,1-3H3 |
| InChIKey | NWLAPWGJGZPOHC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|