C22H32N6O10 — CID 173389873
[(2S)-2-amino-3-[4-[(2S)-2-amino-3-[(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl]oxypropanoyl]oxyphenyl]propanoyl] (2S)-2,4-diamino-4-oxobutanoate (PubChem CID 173389873) has the molecular formula C22H32N6O10 and a molecular weight of 540.53 g/mol. Its IUPAC name is [(2S)-2-amino-3-[4-[(2S)-2-amino-3-[(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl]oxypropanoyl]oxyphenyl]propanoyl] (2S)-2,4-diamino-4-oxobutanoate.
| Compound Name | [(2S)-2-amino-3-[4-[(2S)-2-amino-3-[(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl]oxypropanoyl]oxyphenyl]propanoyl] (2S)-2,4-diamino-4-oxobutanoate |
|---|---|
| PubChem CID | 173389873 |
| Molecular Formula | C22H32N6O10 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | [(2S)-2-amino-3-[4-[(2S)-2-amino-3-[(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl]oxypropanoyl]oxyphenyl]propanoyl] (2S)-2,4-diamino-4-oxobutanoate |
| SMILES | C[C@H](N)C(=O)OC[C@H](N)C(=O)OC[C@H](N)C(=O)Oc1ccc(C[C@H](N)C(=O)OC(=O)[C@@H](N)CC(N)=O)cc1 |
| InChI | InChI=1S/C22H32N6O10/c1-10(23)18(30)35-8-15(26)19(31)36-9-16(27)22(34)37-12-4-2-11(3-5-12)6-13(24)20(32)38-21(33)14(25)7-17(28)29/h2-5,10,13-16H,6-9,23-27H2,1H3,(H2,28,29)/t10-,13-,14-,15-,16-/m0/s1 |
| InChIKey | KHOLJMFRCKCQOQ-QZXGQWDYSA-N |
| XLogP | -4.18 |
| TPSA | 295.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|