C9H13NO8 — CID 173389962
[(3S,3aS,6R,6aS)-6-hydroxy-5-(2-hydroxy-1-oxopropan-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 173389962) has the molecular formula C9H13NO8 and a molecular weight of 263.20 g/mol. Its IUPAC name is [(3S,3aS,6R,6aS)-6-hydroxy-5-(2-hydroxy-1-oxopropan-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [(3S,3aS,6R,6aS)-6-hydroxy-5-(2-hydroxy-1-oxopropan-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 173389962 |
| Molecular Formula | C9H13NO8 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [(3S,3aS,6R,6aS)-6-hydroxy-5-(2-hydroxy-1-oxopropan-2-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | CC(O)(C=O)C1O[C@H]2[C@@H](OC[C@@H]2O[N+](=O)[O-])[C@H]1O |
| InChI | InChI=1S/C9H13NO8/c1-9(13,3-11)8-5(12)7-6(17-8)4(2-16-7)18-10(14)15/h3-8,12-13H,2H2,1H3/t4-,5+,6+,7-,8?,9?/m0/s1 |
| InChIKey | VXKNYBKZRRPQDO-UJXFZWESSA-N |
| XLogP | -1.96 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|