C20H24O3 — CID 173390729
2-[(13S)-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 173390729) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(13S)-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[(13S)-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 173390729 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-[(13S)-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | C[C@@]12CCCC1C1CC(=O)c3cc(CC(=O)O)ccc3C1CC2 |
| InChI | InChI=1S/C20H24O3/c1-20-7-2-3-17(20)15-11-18(21)16-9-12(10-19(22)23)4-5-13(16)14(15)6-8-20/h4-5,9,14-15,17H,2-3,6-8,10-11H2,1H3,(H,22,23)/t14?,15?,17?,20-/m0/s1 |
| InChIKey | OEVUCMAQLNMZJV-ZXGDDTLZSA-N |
| XLogP | 4.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |