About 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate
2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate (PubChem CID 173390920) has the molecular formula C24H54NO10P
and a molecular weight of 547.67 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate |
| PubChem CID | 173390920 |
| Molecular Formula | C24H54NO10P |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate |
| SMILES | CCCCCCCCCOP(=O)(O)OCCCCCCCCC.OCCON(OCCO)OCCO |
| InChI | InChI=1S/C18H39O4P.C6H15NO6/c1-3-5-7-9-11-13-15-17-21-23(19,20)22-18-16-14-12-10-8-6-4-2;8-1-4-11-7(12-5-2-9)13-6-3-10/h3-18H2,1-2H3,(H,19,20);8-10H,1-6H2 |
| InChIKey | XULHIXJRJAPIOR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate?
The IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate (CID 173390920) is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate.
What is the SMILES notation for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate?
The canonical SMILES for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate is CCCCCCCCCOP(=O)(O)OCCCCCCCCC.OCCON(OCCO)OCCO.
What is the InChIKey of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate?
The InChIKey is XULHIXJRJAPIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39O4P.C6H15NO6/c1-3-5-7-9-11-13-15-17-21-23(19,20)22-18-16-14-12-10-8-6-4-2;8-1-4-11-7(12-5-2-9)13-6-3-10/h3-18H2,1-2H3,(H,19,20);8-10H,1-6H2.
What are the key properties of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate?
2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate has a molecular weight of 547.67 g/mol, XLogP of 4.68, 27 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;dinonyl hydrogen phosphate is sourced from PubChem (CID 173390920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).