About 3-dimethylsilyl-2,2-dimethyldecan-3-ol
3-dimethylsilyl-2,2-dimethyldecan-3-ol (PubChem CID 173390957) has the molecular formula C14H32OSi
and a molecular weight of 244.49 g/mol. Its IUPAC name is 3-dimethylsilyl-2,2-dimethyldecan-3-ol.
Molecular Properties
| Compound Name | 3-dimethylsilyl-2,2-dimethyldecan-3-ol |
| PubChem CID | 173390957 |
| Molecular Formula | C14H32OSi |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-dimethylsilyl-2,2-dimethyldecan-3-ol |
| SMILES | CCCCCCCC(O)([SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C14H32OSi/c1-7-8-9-10-11-12-14(15,16(5)6)13(2,3)4/h15-16H,7-12H2,1-6H3 |
| InChIKey | AWXWPHDMAUWFKG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-dimethylsilyl-2,2-dimethyldecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethylsilyl-2,2-dimethyldecan-3-ol?
The IUPAC name of 3-dimethylsilyl-2,2-dimethyldecan-3-ol (CID 173390957) is 3-dimethylsilyl-2,2-dimethyldecan-3-ol.
What is the SMILES notation for 3-dimethylsilyl-2,2-dimethyldecan-3-ol?
The canonical SMILES for 3-dimethylsilyl-2,2-dimethyldecan-3-ol is CCCCCCCC(O)([SiH](C)C)C(C)(C)C.
What is the InChIKey of 3-dimethylsilyl-2,2-dimethyldecan-3-ol?
The InChIKey is AWXWPHDMAUWFKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32OSi/c1-7-8-9-10-11-12-14(15,16(5)6)13(2,3)4/h15-16H,7-12H2,1-6H3.
What are the key properties of 3-dimethylsilyl-2,2-dimethyldecan-3-ol?
3-dimethylsilyl-2,2-dimethyldecan-3-ol has a molecular weight of 244.49 g/mol, XLogP of 4.15, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethylsilyl-2,2-dimethyldecan-3-ol is sourced from PubChem (CID 173390957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).