C20H33N3O5Si — CID 173391028
prop-2-enyl (4R)-2-diazo-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxohexanoate (PubChem CID 173391028) has the molecular formula C20H33N3O5Si and a molecular weight of 423.59 g/mol. Its IUPAC name is prop-2-enyl (4R)-2-diazo-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxohexanoate.
| Compound Name | prop-2-enyl (4R)-2-diazo-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxohexanoate |
|---|---|
| PubChem CID | 173391028 |
| Molecular Formula | C20H33N3O5Si |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | prop-2-enyl (4R)-2-diazo-4-[(2R,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxohexanoate |
| SMILES | C=CCOC(=O)C(=[N+]=[N-])C(=O)[C@H](CC)[C@H]1NC(=O)[C@@H]1[C@@](C)(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C20H33N3O5Si/c1-9-11-27-18(26)15(23-21)16(24)12(10-2)14-13(17(25)22-14)20(6,19(3,4)5)28-29(7)8/h9,12-14,29H,1,10-11H2,2-8H3,(H,22,25)/t12-,13-,14-,20-/m1/s1 |
| InChIKey | YKGLOYLUUAWZAK-POLYTFBCSA-N |
| XLogP | 1.90 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|