About 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile
2-fluoro-1,4-dihydropyrimidine-5-carbonitrile (PubChem CID 173391283) has the molecular formula C5H4FN3
and a molecular weight of 125.11 g/mol. Its IUPAC name is 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile |
| PubChem CID | 173391283 |
| Molecular Formula | C5H4FN3 |
| Molecular Weight | 125.11 g/mol |
| Exact Mass | 125.04 |
| IUPAC Name | 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile |
| SMILES | N#CC1=CNC(F)=NC1 |
| InChI | InChI=1S/C5H4FN3/c6-5-8-2-4(1-7)3-9-5/h2H,3H2,(H,8,9) |
| InChIKey | VBGFQLWYLLWHFC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.11 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile?
The IUPAC name of 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile (CID 173391283) is 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile.
What is the SMILES notation for 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile?
The canonical SMILES for 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile is N#CC1=CNC(F)=NC1.
What is the InChIKey of 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile?
The InChIKey is VBGFQLWYLLWHFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FN3/c6-5-8-2-4(1-7)3-9-5/h2H,3H2,(H,8,9).
What are the key properties of 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile?
2-fluoro-1,4-dihydropyrimidine-5-carbonitrile has a molecular weight of 125.11 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,4-dihydropyrimidine-5-carbonitrile is sourced from PubChem (CID 173391283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).