About 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol
5-(dihydroxymethyl)benzene-1,2,3,4-tetrol (PubChem CID 173391371) has the molecular formula C7H8O6
and a molecular weight of 188.13 g/mol. Its IUPAC name is 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol.
Molecular Properties
| Compound Name | 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol |
| PubChem CID | 173391371 |
| Molecular Formula | C7H8O6 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol |
| SMILES | Oc1cc(C(O)O)c(O)c(O)c1O |
| InChI | InChI=1S/C7H8O6/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,7-13H |
| InChIKey | XHEKUFUSURPDML-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol?
The IUPAC name of 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol (CID 173391371) is 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol.
What is the SMILES notation for 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol?
The canonical SMILES for 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol is Oc1cc(C(O)O)c(O)c(O)c1O.
What is the InChIKey of 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol?
The InChIKey is XHEKUFUSURPDML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O6/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,7-13H.
What are the key properties of 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol?
5-(dihydroxymethyl)benzene-1,2,3,4-tetrol has a molecular weight of 188.13 g/mol, XLogP of -0.51, 1 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dihydroxymethyl)benzene-1,2,3,4-tetrol is sourced from PubChem (CID 173391371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).