C14H16Cl3NO5 — CID 173392271
3,4,5-trihydroxy-1-[(3,5,6-trichloro-2-pyridinyl)oxy]non-5-en-2-one (PubChem CID 173392271) has the molecular formula C14H16Cl3NO5 and a molecular weight of 384.64 g/mol. Its IUPAC name is 3,4,5-trihydroxy-1-[(3,5,6-trichloro-2-pyridinyl)oxy]non-5-en-2-one.
| Compound Name | 3,4,5-trihydroxy-1-[(3,5,6-trichloro-2-pyridinyl)oxy]non-5-en-2-one |
|---|---|
| PubChem CID | 173392271 |
| Molecular Formula | C14H16Cl3NO5 |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 3,4,5-trihydroxy-1-[(3,5,6-trichloro-2-pyridinyl)oxy]non-5-en-2-one |
| SMILES | CCCC=C(O)C(O)C(O)C(=O)COc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl3NO5/c1-2-3-4-9(19)11(21)12(22)10(20)6-23-14-8(16)5-7(15)13(17)18-14/h4-5,11-12,19,21-22H,2-3,6H2,1H3 |
| InChIKey | JJXDTRWRZJYSOG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|