About chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran
chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran (PubChem CID 173392423) has the molecular formula C12H20CrO7
and a molecular weight of 328.28 g/mol. Its IUPAC name is chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran.
Molecular Properties
| Compound Name | chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran |
| PubChem CID | 173392423 |
| Molecular Formula | C12H20CrO7 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran |
| SMILES | C=O.C=O.C=O.C=O.C=O.COCc1ccc(C)o1.[Cr] |
| InChI | InChI=1S/C7H10O2.5CH2O.Cr/c1-6-3-4-7(9-6)5-8-2;5*1-2;/h3-4H,5H2,1-2H3;5*1H2; |
| InChIKey | GMXAVQPJZKXITL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 107.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran?
The IUPAC name of chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran (CID 173392423) is chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran.
What is the SMILES notation for chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran?
The canonical SMILES for chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran is C=O.C=O.C=O.C=O.C=O.COCc1ccc(C)o1.[Cr].
What is the InChIKey of chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran?
The InChIKey is GMXAVQPJZKXITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2.5CH2O.Cr/c1-6-3-4-7(9-6)5-8-2;5*1-2;/h3-4H,5H2,1-2H3;5*1H2;.
What are the key properties of chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran?
chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran has a molecular weight of 328.28 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;formaldehyde;2-(methoxymethyl)-5-methylfuran is sourced from PubChem (CID 173392423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).