C15H12FNO5 — CID 17339245
dimethyl 1-(4-fluorophenyl)-4-oxopyridine-3,5-dicarboxylate (PubChem CID 17339245) has the molecular formula C15H12FNO5 and a molecular weight of 305.26 g/mol. Its IUPAC name is dimethyl 1-(4-fluorophenyl)-4-oxopyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 1-(4-fluorophenyl)-4-oxopyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 17339245 |
| Molecular Formula | C15H12FNO5 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | dimethyl 1-(4-fluorophenyl)-4-oxopyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1cn(-c2ccc(F)cc2)cc(C(=O)OC)c1=O |
| InChI | InChI=1S/C15H12FNO5/c1-21-14(19)11-7-17(10-5-3-9(16)4-6-10)8-12(13(11)18)15(20)22-2/h3-8H,1-2H3 |
| InChIKey | CFDHTCGXNHJIOS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |